C26H17Cl4N7O3 — CID 23483166
2,4-dichloro-N'-[6-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylanilino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23483166) has the molecular formula C26H17Cl4N7O3 and a molecular weight of 617.28 g/mol. Its IUPAC name is 2,4-dichloro-N'-[6-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylanilino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 2,4-dichloro-N'-[6-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylanilino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23483166 |
| Molecular Formula | C26H17Cl4N7O3 |
| Molecular Weight | 617.28 g/mol |
| Exact Mass | 615.01 |
| IUPAC Name | 2,4-dichloro-N'-[6-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylanilino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1Nc1ncnc(NNC(=O)c2ccc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H17Cl4N7O3/c1-13-8-18(19(11-31)14-2-4-15(27)5-3-14)21(30)10-22(13)34-24-23(37(39)40)25(33-12-32-24)35-36-26(38)17-7-6-16(28)9-20(17)29/h2-10,12,19H,1H3,(H,36,38)(H2,32,33,34,35) |
| InChIKey | VGDPMBRZJZHYOI-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.28 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|