C25H19Cl2N7O2 — CID 23480759
2-[2-chloro-5-methyl-4-[[6-[(6-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 23480759) has the molecular formula C25H19Cl2N7O2 and a molecular weight of 520.38 g/mol. Its IUPAC name is 2-[2-chloro-5-methyl-4-[[6-[(6-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[2-chloro-5-methyl-4-[[6-[(6-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23480759 |
| Molecular Formula | C25H19Cl2N7O2 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 2-[2-chloro-5-methyl-4-[[6-[(6-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | Cc1cccc(Nc2ncnc(Nc3cc(Cl)c(C(C#N)c4ccc(Cl)cc4)cc3C)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C25H19Cl2N7O2/c1-14-10-18(19(12-28)16-6-8-17(26)9-7-16)20(27)11-21(14)32-24-23(34(35)36)25(30-13-29-24)33-22-5-3-4-15(2)31-22/h3-11,13,19H,1-2H3,(H2,29,30,31,32,33) |
| InChIKey | GWEKROINTHLTKJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|