C28H22Cl2N6O4 — CID 23483107
ethyl 4-[[6-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylanilino]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 23483107) has the molecular formula C28H22Cl2N6O4 and a molecular weight of 577.43 g/mol. Its IUPAC name is ethyl 4-[[6-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylanilino]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[6-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylanilino]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 23483107 |
| Molecular Formula | C28H22Cl2N6O4 |
| Molecular Weight | 577.43 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | ethyl 4-[[6-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylanilino]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncnc(Nc3cc(Cl)c(C(C#N)c4ccc(Cl)cc4)cc3C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H22Cl2N6O4/c1-3-40-28(37)18-6-10-20(11-7-18)34-26-25(36(38)39)27(33-15-32-26)35-24-13-23(30)21(12-16(24)2)22(14-31)17-4-8-19(29)9-5-17/h4-13,15,22H,3H2,1-2H3,(H2,32,33,34,35) |
| InChIKey | OAMAKLWQTRYIGU-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 143.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.43 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|