C25H25Cl2N7O3 — CID 23483067
2-[2-chloro-4-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 23483067) has the molecular formula C25H25Cl2N7O3 and a molecular weight of 542.43 g/mol. Its IUPAC name is 2-[2-chloro-4-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[2-chloro-4-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23483067 |
| Molecular Formula | C25H25Cl2N7O3 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 2-[2-chloro-4-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1Nc1ncnc(N2CCN(CCO)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H25Cl2N7O3/c1-16-12-19(20(14-28)17-2-4-18(26)5-3-17)21(27)13-22(16)31-24-23(34(36)37)25(30-15-29-24)33-8-6-32(7-9-33)10-11-35/h2-5,12-13,15,20,35H,6-11H2,1H3,(H,29,30,31) |
| InChIKey | QPCNHAHQGLYAPV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|