C23H22Cl2N6O2 — CID 23483217
2-[4-[[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 23483217) has the molecular formula C23H22Cl2N6O2 and a molecular weight of 485.38 g/mol. Its IUPAC name is 2-[4-[[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[4-[[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23483217 |
| Molecular Formula | C23H22Cl2N6O2 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 2-[4-[[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | CCC(C)Nc1ncnc(Nc2cc(Cl)c(C(C#N)c3ccc(Cl)cc3)cc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22Cl2N6O2/c1-4-14(3)29-22-21(31(32)33)23(28-12-27-22)30-20-10-19(25)17(9-13(20)2)18(11-26)15-5-7-16(24)8-6-15/h5-10,12,14,18H,4H2,1-3H3,(H2,27,28,29,30) |
| InChIKey | QEKUMGUEFIBWJK-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|