C27H22Cl2N6O2 — CID 23483102
2-[2-chloro-5-methyl-4-[[5-nitro-6-(1-phenylethylamino)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 23483102) has the molecular formula C27H22Cl2N6O2 and a molecular weight of 533.42 g/mol. Its IUPAC name is 2-[2-chloro-5-methyl-4-[[5-nitro-6-(1-phenylethylamino)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[2-chloro-5-methyl-4-[[5-nitro-6-(1-phenylethylamino)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23483102 |
| Molecular Formula | C27H22Cl2N6O2 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2-[2-chloro-5-methyl-4-[[5-nitro-6-(1-phenylethylamino)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1Nc1ncnc(NC(C)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C27H22Cl2N6O2/c1-16-12-21(22(14-30)19-8-10-20(28)11-9-19)23(29)13-24(16)34-27-25(35(36)37)26(31-15-32-27)33-17(2)18-6-4-3-5-7-18/h3-13,15,17,22H,1-2H3,(H2,31,32,33,34) |
| InChIKey | BKDZPMFZVOTHNT-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|