C26H17Cl2N7O2S — CID 23483104
2-[4-[[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 23483104) has the molecular formula C26H17Cl2N7O2S and a molecular weight of 562.44 g/mol. Its IUPAC name is 2-[4-[[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[4-[[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23483104 |
| Molecular Formula | C26H17Cl2N7O2S |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | 2-[4-[[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1Nc1ncnc(Nc2nc3ccccc3s2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H17Cl2N7O2S/c1-14-10-17(18(12-29)15-6-8-16(27)9-7-15)19(28)11-21(14)32-24-23(35(36)37)25(31-13-30-24)34-26-33-20-4-2-3-5-22(20)38-26/h2-11,13,18H,1H3,(H2,30,31,32,33,34) |
| InChIKey | KZLNJHMFWMATOZ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|