C20H24BrN5O2 — CID 23492805
N-(2-bromophenyl)-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine (PubChem CID 23492805) has the molecular formula C20H24BrN5O2 and a molecular weight of 446.35 g/mol. Its IUPAC name is N-(2-bromophenyl)-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine.
| Compound Name | N-(2-bromophenyl)-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23492805 |
| Molecular Formula | C20H24BrN5O2 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-(2-bromophenyl)-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
| SMILES | CC1(C)CC2CC(C)(CN2c2ncnc(Nc3ccccc3Br)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H24BrN5O2/c1-19(2)8-13-9-20(3,10-19)11-25(13)18-16(26(27)28)17(22-12-23-18)24-15-7-5-4-6-14(15)21/h4-7,12-13H,8-11H2,1-3H3,(H,22,23,24) |
| InChIKey | QXVXEWOAICJAAY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|