C20H31N5O2 — CID 23489702
6-[6-(azepan-1-yl)-5-nitropyrimidin-4-yl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane (PubChem CID 23489702) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 6-[6-(azepan-1-yl)-5-nitropyrimidin-4-yl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane.
| Compound Name | 6-[6-(azepan-1-yl)-5-nitropyrimidin-4-yl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 23489702 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 6-[6-(azepan-1-yl)-5-nitropyrimidin-4-yl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)CC2CC(C)(CN2c2ncnc(N3CCCCCC3)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H31N5O2/c1-19(2)10-15-11-20(3,12-19)13-24(15)18-16(25(26)27)17(21-14-22-18)23-8-6-4-5-7-9-23/h14-15H,4-13H2,1-3H3 |
| InChIKey | WLGPFWFFKDFNAZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|