C26H30N6O2 — CID 23492881
N-benzyl-5-nitro-N-pyridin-2-yl-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine (PubChem CID 23492881) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is N-benzyl-5-nitro-N-pyridin-2-yl-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine.
| Compound Name | N-benzyl-5-nitro-N-pyridin-2-yl-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23492881 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N-benzyl-5-nitro-N-pyridin-2-yl-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
| SMILES | CC1(C)CC2CC(C)(CN2c2ncnc(N(Cc3ccccc3)c3ccccn3)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C26H30N6O2/c1-25(2)13-20-14-26(3,16-25)17-31(20)24-22(32(33)34)23(28-18-29-24)30(21-11-7-8-12-27-21)15-19-9-5-4-6-10-19/h4-12,18,20H,13-17H2,1-3H3 |
| InChIKey | FLNMGIXAUQYYOD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|