C26H28N6O2 — CID 22525817
6-N-(1-adamantyl)-4-N-benzyl-5-nitro-4-N-pyridin-2-ylpyrimidine-4,6-diamine (PubChem CID 22525817) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 6-N-(1-adamantyl)-4-N-benzyl-5-nitro-4-N-pyridin-2-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(1-adamantyl)-4-N-benzyl-5-nitro-4-N-pyridin-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22525817 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 6-N-(1-adamantyl)-4-N-benzyl-5-nitro-4-N-pyridin-2-ylpyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NC23CC4CC(CC(C4)C2)C3)ncnc1N(Cc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C26H28N6O2/c33-32(34)23-24(30-26-13-19-10-20(14-26)12-21(11-19)15-26)28-17-29-25(23)31(22-8-4-5-9-27-22)16-18-6-2-1-3-7-18/h1-9,17,19-21H,10-16H2,(H,28,29,30) |
| InChIKey | CODQVFINJPROPI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|