C21H17N7O2 — CID 23482076
4-N-benzyl-5-nitro-4-N-pyridin-2-yl-6-N-pyridin-4-ylpyrimidine-4,6-diamine (PubChem CID 23482076) has the molecular formula C21H17N7O2 and a molecular weight of 399.41 g/mol. Its IUPAC name is 4-N-benzyl-5-nitro-4-N-pyridin-2-yl-6-N-pyridin-4-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-benzyl-5-nitro-4-N-pyridin-2-yl-6-N-pyridin-4-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23482076 |
| Molecular Formula | C21H17N7O2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-N-benzyl-5-nitro-4-N-pyridin-2-yl-6-N-pyridin-4-ylpyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccncc2)ncnc1N(Cc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C21H17N7O2/c29-28(30)19-20(26-17-9-12-22-13-10-17)24-15-25-21(19)27(18-8-4-5-11-23-18)14-16-6-2-1-3-7-16/h1-13,15H,14H2,(H,22,24,25,26) |
| InChIKey | STDQDGBEARUVCJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|