C22H16BrFN6O2 — CID 22537712
4-N-benzyl-6-N-(4-bromo-2-fluorophenyl)-5-nitro-4-N-pyridin-2-ylpyrimidine-4,6-diamine (PubChem CID 22537712) has the molecular formula C22H16BrFN6O2 and a molecular weight of 495.31 g/mol. Its IUPAC name is 4-N-benzyl-6-N-(4-bromo-2-fluorophenyl)-5-nitro-4-N-pyridin-2-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-benzyl-6-N-(4-bromo-2-fluorophenyl)-5-nitro-4-N-pyridin-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22537712 |
| Molecular Formula | C22H16BrFN6O2 |
| Molecular Weight | 495.31 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 4-N-benzyl-6-N-(4-bromo-2-fluorophenyl)-5-nitro-4-N-pyridin-2-ylpyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(Br)cc2F)ncnc1N(Cc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C22H16BrFN6O2/c23-16-9-10-18(17(24)12-16)28-21-20(30(31)32)22(27-14-26-21)29(19-8-4-5-11-25-19)13-15-6-2-1-3-7-15/h1-12,14H,13H2,(H,26,27,28) |
| InChIKey | MDWFOPVKDVRPRU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.31 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|