C19H20N6O2 — CID 23487420
4-N-benzyl-5-nitro-6-N-propyl-4-N-pyridin-2-ylpyrimidine-4,6-diamine (PubChem CID 23487420) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-N-benzyl-5-nitro-6-N-propyl-4-N-pyridin-2-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-benzyl-5-nitro-6-N-propyl-4-N-pyridin-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23487420 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-N-benzyl-5-nitro-6-N-propyl-4-N-pyridin-2-ylpyrimidine-4,6-diamine |
| SMILES | CCCNc1ncnc(N(Cc2ccccc2)c2ccccn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N6O2/c1-2-11-21-18-17(25(26)27)19(23-14-22-18)24(16-10-6-7-12-20-16)13-15-8-4-3-5-9-15/h3-10,12,14H,2,11,13H2,1H3,(H,21,22,23) |
| InChIKey | JGEYODPKBNAXQY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|