C22H29N5O2 — CID 23477958
N-benzyl-N-methyl-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine (PubChem CID 23477958) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-benzyl-N-methyl-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine.
| Compound Name | N-benzyl-N-methyl-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23477958 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N-benzyl-N-methyl-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
| SMILES | CN(Cc1ccccc1)c1ncnc(N2CC3(C)CC2CC(C)(C)C3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H29N5O2/c1-21(2)10-17-11-22(3,13-21)14-26(17)20-18(27(28)29)19(23-15-24-20)25(4)12-16-8-6-5-7-9-16/h5-9,15,17H,10-14H2,1-4H3 |
| InChIKey | SOBJHILTRLGYEU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|