C20H23Cl2N5O2 — CID 23485447
N-(3,4-dichlorophenyl)-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine (PubChem CID 23485447) has the molecular formula C20H23Cl2N5O2 and a molecular weight of 436.34 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine.
| Compound Name | N-(3,4-dichlorophenyl)-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23485447 |
| Molecular Formula | C20H23Cl2N5O2 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
| SMILES | CC1(C)CC2CC(C)(CN2c2ncnc(Nc3ccc(Cl)c(Cl)c3)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H23Cl2N5O2/c1-19(2)7-13-8-20(3,9-19)10-26(13)18-16(27(28)29)17(23-11-24-18)25-12-4-5-14(21)15(22)6-12/h4-6,11,13H,7-10H2,1-3H3,(H,23,24,25) |
| InChIKey | VUGVCTIYWKMDSX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|