C14H13Cl2N5O2 — CID 23485427
N-(3,4-dichlorophenyl)-5-nitro-6-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 23485427) has the molecular formula C14H13Cl2N5O2 and a molecular weight of 354.20 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-nitro-6-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(3,4-dichlorophenyl)-5-nitro-6-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23485427 |
| Molecular Formula | C14H13Cl2N5O2 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-nitro-6-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(Cl)c(Cl)c2)ncnc1N1CCCC1 |
| InChI | InChI=1S/C14H13Cl2N5O2/c15-10-4-3-9(7-11(10)16)19-13-12(21(22)23)14(18-8-17-13)20-5-1-2-6-20/h3-4,7-8H,1-2,5-6H2,(H,17,18,19) |
| InChIKey | DVIUZQPJEKJIID-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|