C22H33N5O4 — CID 23492759
ethyl 1-[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 23492759) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is ethyl 1-[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23492759 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | ethyl 1-[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(N3CC4(C)CC3CC(C)(C)C4)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H33N5O4/c1-5-31-20(28)15-6-8-25(9-7-15)18-17(27(29)30)19(24-14-23-18)26-13-22(4)11-16(26)10-21(2,3)12-22/h14-16H,5-13H2,1-4H3 |
| InChIKey | QSPPTHYGBLLOMR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|