C10H10N2O3 — CID 86623793
N-methoxy-4-nitro-2,3-dihydroinden-1-imine (PubChem CID 86623793) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is N-methoxy-4-nitro-2,3-dihydroinden-1-imine.
| Compound Name | N-methoxy-4-nitro-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 86623793 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | N-methoxy-4-nitro-2,3-dihydroinden-1-imine |
| SMILES | CON=C1CCc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O3/c1-15-11-9-6-5-8-7(9)3-2-4-10(8)12(13)14/h2-4H,5-6H2,1H3 |
| InChIKey | BWXMAOFLMIVMER-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|