C9H7NO5 — CID 170549355
6-nitro-1,5-dihydro-2,4-benzodioxepin-3-one (PubChem CID 170549355) has the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. Its IUPAC name is 6-nitro-1,5-dihydro-2,4-benzodioxepin-3-one.
| Compound Name | 6-nitro-1,5-dihydro-2,4-benzodioxepin-3-one |
|---|---|
| PubChem CID | 170549355 |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 6-nitro-1,5-dihydro-2,4-benzodioxepin-3-one |
| SMILES | O=C1OCc2cccc([N+](=O)[O-])c2CO1 |
| InChI | InChI=1S/C9H7NO5/c11-9-14-4-6-2-1-3-8(10(12)13)7(6)5-15-9/h1-3H,4-5H2 |
| InChIKey | SZGAWZWYYOBLAS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|