C11H14N2O4S — CID 71648194
N-methyl-1-(4-nitro-2,3-dihydro-1H-inden-2-yl)methanesulfonamide (PubChem CID 71648194) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N-methyl-1-(4-nitro-2,3-dihydro-1H-inden-2-yl)methanesulfonamide.
| Compound Name | N-methyl-1-(4-nitro-2,3-dihydro-1H-inden-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 71648194 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-methyl-1-(4-nitro-2,3-dihydro-1H-inden-2-yl)methanesulfonamide |
| SMILES | CNS(=O)(=O)CC1Cc2cccc([N+](=O)[O-])c2C1 |
| InChI | InChI=1S/C11H14N2O4S/c1-12-18(16,17)7-8-5-9-3-2-4-11(13(14)15)10(9)6-8/h2-4,8,12H,5-7H2,1H3 |
| InChIKey | AXOVWQAWEDJUQU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|