C20H21BrN2O2 — CID 25019318
(1R,10R)-11-[(3-bromophenyl)methyl]-7-nitro-11-azatricyclo[8.2.2.03,8]tetradeca-3(8),4,6-triene (PubChem CID 25019318) has the molecular formula C20H21BrN2O2 and a molecular weight of 401.30 g/mol. Its IUPAC name is (1R,10R)-11-[(3-bromophenyl)methyl]-7-nitro-11-azatricyclo[8.2.2.03,8]tetradeca-3(8),4,6-triene.
| Compound Name | (1R,10R)-11-[(3-bromophenyl)methyl]-7-nitro-11-azatricyclo[8.2.2.03,8]tetradeca-3(8),4,6-triene |
|---|---|
| PubChem CID | 25019318 |
| Molecular Formula | C20H21BrN2O2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (1R,10R)-11-[(3-bromophenyl)methyl]-7-nitro-11-azatricyclo[8.2.2.03,8]tetradeca-3(8),4,6-triene |
| SMILES | O=[N+]([O-])c1cccc2c1C[C@H]1CC[C@H](C2)CN1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C20H21BrN2O2/c21-17-5-1-3-14(10-17)12-22-13-15-7-8-18(22)11-19-16(9-15)4-2-6-20(19)23(24)25/h1-6,10,15,18H,7-9,11-13H2/t15-,18-/m1/s1 |
| InChIKey | FXUIYISCEOXDPA-CRAIPNDOSA-N |
| XLogP | 4.74 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|