C20H25N2O2+ — CID 142819212
[4-[[(1R,10S)-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-trien-11-yl]methyl]phenyl]-dihydroxyazanium (PubChem CID 142819212) has the molecular formula C20H25N2O2+ and a molecular weight of 325.43 g/mol. Its IUPAC name is [4-[[(1R,10S)-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-trien-11-yl]methyl]phenyl]-dihydroxyazanium.
| Compound Name | [4-[[(1R,10S)-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-trien-11-yl]methyl]phenyl]-dihydroxyazanium |
|---|---|
| PubChem CID | 142819212 |
| Molecular Formula | C20H25N2O2+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [4-[[(1R,10S)-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-trien-11-yl]methyl]phenyl]-dihydroxyazanium |
| SMILES | O[NH+](O)c1ccc(CN2C[C@@H]3CC[C@H]2Cc2ccccc2C3)cc1 |
| InChI | InChI=1S/C20H24N2O2/c23-22(24)19-8-5-15(6-9-19)13-21-14-16-7-10-20(21)12-18-4-2-1-3-17(18)11-16/h1-6,8-9,16,20,23-24H,7,10-14H2/p+1/t16-,20+/m1/s1 |
| InChIKey | NRRUVPAQWONDPB-UZLBHIALSA-O |
| XLogP | 2.36 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|