C20H24N2 — CID 25019324
2-[[(1R,10R)-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-trien-11-yl]methyl]aniline (PubChem CID 25019324) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-[[(1R,10R)-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-trien-11-yl]methyl]aniline.
| Compound Name | 2-[[(1R,10R)-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-trien-11-yl]methyl]aniline |
|---|---|
| PubChem CID | 25019324 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-[[(1R,10R)-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-trien-11-yl]methyl]aniline |
| SMILES | Nc1ccccc1CN1C[C@@H]2CC[C@@H]1Cc1ccccc1C2 |
| InChI | InChI=1S/C20H24N2/c21-20-8-4-3-7-18(20)14-22-13-15-9-10-19(22)12-17-6-2-1-5-16(17)11-15/h1-8,15,19H,9-14,21H2/t15-,19-/m1/s1 |
| InChIKey | XXNCZVXJLLSLES-DNVCBOLYSA-N |
| XLogP | 3.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|