C11H12N4O5 — CID 175355474
methyl azetidine-3-carboxylate;4-nitro-2,1,3-benzoxadiazole (PubChem CID 175355474) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is methyl azetidine-3-carboxylate;4-nitro-2,1,3-benzoxadiazole.
| Compound Name | methyl azetidine-3-carboxylate;4-nitro-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 175355474 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | methyl azetidine-3-carboxylate;4-nitro-2,1,3-benzoxadiazole |
| SMILES | COC(=O)C1CNC1.O=[N+]([O-])c1cccc2nonc12 |
| InChI | InChI=1S/C6H3N3O3.C5H9NO2/c10-9(11)5-3-1-2-4-6(5)8-12-7-4;1-8-5(7)4-2-6-3-4/h1-3H;4,6H,2-3H2,1H3 |
| InChIKey | ZECCMKHFMFMECD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|