C10H9N3O4 — CID 88694497
4-(2,1,3-benzoxadiazol-4-yl)-3-nitrobutan-2-one (PubChem CID 88694497) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 4-(2,1,3-benzoxadiazol-4-yl)-3-nitrobutan-2-one.
| Compound Name | 4-(2,1,3-benzoxadiazol-4-yl)-3-nitrobutan-2-one |
|---|---|
| PubChem CID | 88694497 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 4-(2,1,3-benzoxadiazol-4-yl)-3-nitrobutan-2-one |
| SMILES | CC(=O)C(Cc1cccc2nonc12)[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N3O4/c1-6(14)9(13(15)16)5-7-3-2-4-8-10(7)12-17-11-8/h2-4,9H,5H2,1H3 |
| InChIKey | ZWTCXCQNRZENLI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 99.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|