C12H10N2O3 — CID 20722951
3-(2,1,3-benzoxadiazol-5-ylmethylidene)pentane-2,4-dione (PubChem CID 20722951) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 3-(2,1,3-benzoxadiazol-5-ylmethylidene)pentane-2,4-dione.
| Compound Name | 3-(2,1,3-benzoxadiazol-5-ylmethylidene)pentane-2,4-dione |
|---|---|
| PubChem CID | 20722951 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-(2,1,3-benzoxadiazol-5-ylmethylidene)pentane-2,4-dione |
| SMILES | CC(=O)C(=Cc1ccc2nonc2c1)C(C)=O |
| InChI | InChI=1S/C12H10N2O3/c1-7(15)10(8(2)16)5-9-3-4-11-12(6-9)14-17-13-11/h3-6H,1-2H3 |
| InChIKey | MYQBFOBXTQMCHX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|