C12H10N4O7 — CID 168567266
dimethyl (E)-2-[(5-nitro-2,1,3-benzoxadiazol-4-yl)amino]but-2-enedioate (PubChem CID 168567266) has the molecular formula C12H10N4O7 and a molecular weight of 322.23 g/mol. Its IUPAC name is dimethyl (E)-2-[(5-nitro-2,1,3-benzoxadiazol-4-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(5-nitro-2,1,3-benzoxadiazol-4-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168567266 |
| Molecular Formula | C12H10N4O7 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | dimethyl (E)-2-[(5-nitro-2,1,3-benzoxadiazol-4-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1c([N+](=O)[O-])ccc2nonc12)C(=O)OC |
| InChI | InChI=1S/C12H10N4O7/c1-21-9(17)5-7(12(18)22-2)13-11-8(16(19)20)4-3-6-10(11)15-23-14-6/h3-5,13H,1-2H3/b7-5+ |
| InChIKey | LGIFXHMFECDQJR-FNORWQNLSA-N |
| XLogP | 0.77 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|