C11H9NO4 — CID 125453711
(1R,1aS,6aS)-5-nitro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid (PubChem CID 125453711) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is (1R,1aS,6aS)-5-nitro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid.
| Compound Name | (1R,1aS,6aS)-5-nitro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
|---|---|
| PubChem CID | 125453711 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (1R,1aS,6aS)-5-nitro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2Cc3c(cccc3[N+](=O)[O-])[C@@H]21 |
| InChI | InChI=1S/C11H9NO4/c13-11(14)10-7-4-6-5(9(7)10)2-1-3-8(6)12(15)16/h1-3,7,9-10H,4H2,(H,13,14)/t7-,9-,10+/m0/s1 |
| InChIKey | NBBLBAZFTMEAGR-UJNFCWOMSA-N |
| XLogP | 1.57 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|