C22H17N3O7S — CID 56992707
(4S,7R,12bR)-7-(1,3-dioxoisoindol-2-yl)-9-nitro-6-oxo-1,3,4,7,8,12b-hexahydro-[1,4]thiazino[3,4-a][2]benzazepine-4-carboxylic acid (PubChem CID 56992707) has the molecular formula C22H17N3O7S and a molecular weight of 467.46 g/mol. Its IUPAC name is (4S,7R,12bR)-7-(1,3-dioxoisoindol-2-yl)-9-nitro-6-oxo-1,3,4,7,8,12b-hexahydro-[1,4]thiazino[3,4-a][2]benzazepine-4-carboxylic acid.
| Compound Name | (4S,7R,12bR)-7-(1,3-dioxoisoindol-2-yl)-9-nitro-6-oxo-1,3,4,7,8,12b-hexahydro-[1,4]thiazino[3,4-a][2]benzazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 56992707 |
| Molecular Formula | C22H17N3O7S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | (4S,7R,12bR)-7-(1,3-dioxoisoindol-2-yl)-9-nitro-6-oxo-1,3,4,7,8,12b-hexahydro-[1,4]thiazino[3,4-a][2]benzazepine-4-carboxylic acid |
| SMILES | O=C(O)[C@H]1CSC[C@H]2c3cccc([N+](=O)[O-])c3C[C@@H](N3C(=O)c4ccccc4C3=O)C(=O)N12 |
| InChI | InChI=1S/C22H17N3O7S/c26-19-12-4-1-2-5-13(12)20(27)24(19)16-8-14-11(6-3-7-15(14)25(31)32)17-9-33-10-18(22(29)30)23(17)21(16)28/h1-7,16-18H,8-10H2,(H,29,30)/t16-,17+,18-/m1/s1 |
| InChIKey | IOMQVEUFRLQDSA-FGTMMUONSA-N |
| XLogP | 1.89 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|