C11H12N2O6S2 — CID 62021637
3-[(2-nitrophenyl)methylsulfonyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 62021637) has the molecular formula C11H12N2O6S2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[(2-nitrophenyl)methylsulfonyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-[(2-nitrophenyl)methylsulfonyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 62021637 |
| Molecular Formula | C11H12N2O6S2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 3-[(2-nitrophenyl)methylsulfonyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSCN1S(=O)(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O6S2/c14-11(15)10-5-20-7-12(10)21(18,19)6-8-3-1-2-4-9(8)13(16)17/h1-4,10H,5-7H2,(H,14,15) |
| InChIKey | QCPSNGWPBVRVNE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|