C10H10ClNO4S2 — CID 43113873
3-(3-chlorophenyl)sulfonyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 43113873) has the molecular formula C10H10ClNO4S2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfonyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(3-chlorophenyl)sulfonyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 43113873 |
| Molecular Formula | C10H10ClNO4S2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 3-(3-chlorophenyl)sulfonyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSCN1S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H10ClNO4S2/c11-7-2-1-3-8(4-7)18(15,16)12-6-17-5-9(12)10(13)14/h1-4,9H,5-6H2,(H,13,14) |
| InChIKey | ZIUXBXXFNSISEO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |