C11H13NO4S2 — CID 7997286
methyl (4S)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 7997286) has the molecular formula C11H13NO4S2 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl (4S)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (4S)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7997286 |
| Molecular Formula | C11H13NO4S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | methyl (4S)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@H]1CSCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H13NO4S2/c1-16-11(13)10-7-17-8-12(10)18(14,15)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | DTYYGENQXCDNEF-SNVBAGLBSA-N |
| XLogP | 0.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |