C19H19ClN2O9S3 — CID 139912567
(2S)-2-[[(4R)-3-(3-chlorophenyl)sulfonyl-1,3-thiazolidine-4-carbonyl]amino]-3-(4-sulfooxyphenyl)propanoic acid (PubChem CID 139912567) has the molecular formula C19H19ClN2O9S3 and a molecular weight of 551.02 g/mol. Its IUPAC name is (2S)-2-[[(4R)-3-(3-chlorophenyl)sulfonyl-1,3-thiazolidine-4-carbonyl]amino]-3-(4-sulfooxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(4R)-3-(3-chlorophenyl)sulfonyl-1,3-thiazolidine-4-carbonyl]amino]-3-(4-sulfooxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 139912567 |
| Molecular Formula | C19H19ClN2O9S3 |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | (2S)-2-[[(4R)-3-(3-chlorophenyl)sulfonyl-1,3-thiazolidine-4-carbonyl]amino]-3-(4-sulfooxyphenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(OS(=O)(=O)O)cc1)NC(=O)[C@@H]1CSCN1S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN2O9S3/c20-13-2-1-3-15(9-13)33(26,27)22-11-32-10-17(22)18(23)21-16(19(24)25)8-12-4-6-14(7-5-12)31-34(28,29)30/h1-7,9,16-17H,8,10-11H2,(H,21,23)(H,24,25)(H,28,29,30)/t16-,17-/m0/s1 |
| InChIKey | QTCFKBLRIBGFRN-IRXDYDNUSA-N |
| XLogP | 1.40 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|