C26H30N4O7S2 — CID 158078115
(2S)-3-[4-[5-(1-aminoethylideneamino)-2,5-dioxopentyl]phenyl]-2-[[(4R)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carbonyl]amino]propanoic acid (PubChem CID 158078115) has the molecular formula C26H30N4O7S2 and a molecular weight of 574.68 g/mol. Its IUPAC name is (2S)-3-[4-[5-(1-aminoethylideneamino)-2,5-dioxopentyl]phenyl]-2-[[(4R)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-[5-(1-aminoethylideneamino)-2,5-dioxopentyl]phenyl]-2-[[(4R)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 158078115 |
| Molecular Formula | C26H30N4O7S2 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | (2S)-3-[4-[5-(1-aminoethylideneamino)-2,5-dioxopentyl]phenyl]-2-[[(4R)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carbonyl]amino]propanoic acid |
| SMILES | C/C(N)=N\C(=O)CCC(=O)Cc1ccc(C[C@H](NC(=O)[C@@H]2CSCN2S(=O)(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H30N4O7S2/c1-17(27)28-24(32)12-11-20(31)13-18-7-9-19(10-8-18)14-22(26(34)35)29-25(33)23-15-38-16-30(23)39(36,37)21-5-3-2-4-6-21/h2-10,22-23H,11-16H2,1H3,(H,29,33)(H,34,35)(H2,27,28,32)/t22-,23-/m0/s1 |
| InChIKey | PAVHHLAHFBQGLH-GOTSBHOMSA-N |
| XLogP | 1.36 |
| TPSA | 176.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|