C36H43N5O7S — CID 159731696
(2S)-3-[4-(8-imino-2-oxononyl)phenyl]-2-[[(2S)-1-[4-(phenylcarbamoylamino)phenyl]sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 159731696) has the molecular formula C36H43N5O7S and a molecular weight of 689.84 g/mol. Its IUPAC name is (2S)-3-[4-(8-imino-2-oxononyl)phenyl]-2-[[(2S)-1-[4-(phenylcarbamoylamino)phenyl]sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-(8-imino-2-oxononyl)phenyl]-2-[[(2S)-1-[4-(phenylcarbamoylamino)phenyl]sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 159731696 |
| Molecular Formula | C36H43N5O7S |
| Molecular Weight | 689.84 g/mol |
| Exact Mass | 689.29 |
| IUPAC Name | (2S)-3-[4-(8-imino-2-oxononyl)phenyl]-2-[[(2S)-1-[4-(phenylcarbamoylamino)phenyl]sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | [H]/N=C(\C)CCCCCC(=O)Cc1ccc(C[C@H](NC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C36H43N5O7S/c1-25(37)9-4-2-7-12-30(42)23-26-14-16-27(17-15-26)24-32(35(44)45)40-34(43)33-13-8-22-41(33)49(47,48)31-20-18-29(19-21-31)39-36(46)38-28-10-5-3-6-11-28/h3,5-6,10-11,14-21,32-33,37H,2,4,7-9,12-13,22-24H2,1H3,(H,40,43)(H,44,45)(H2,38,39,46)/b37-25+/t32-,33-/m0/s1 |
| InChIKey | YNWBIPJVXKKITA-PMDHQIKLSA-N |
| XLogP | 5.40 |
| TPSA | 185.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|