C31H38F3N3O6S — CID 157221902
3-[4-(8-imino-2-oxononyl)phenyl]-2-[[(2S)-1-[3-methyl-5-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 157221902) has the molecular formula C31H38F3N3O6S and a molecular weight of 637.72 g/mol. Its IUPAC name is 3-[4-(8-imino-2-oxononyl)phenyl]-2-[[(2S)-1-[3-methyl-5-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[4-(8-imino-2-oxononyl)phenyl]-2-[[(2S)-1-[3-methyl-5-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 157221902 |
| Molecular Formula | C31H38F3N3O6S |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 637.24 |
| IUPAC Name | 3-[4-(8-imino-2-oxononyl)phenyl]-2-[[(2S)-1-[3-methyl-5-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | [H]/N=C(\C)CCCCCC(=O)Cc1ccc(CC(NC(=O)[C@@H]2CCCN2S(=O)(=O)c2cc(C)cc(C(F)(F)F)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C31H38F3N3O6S/c1-20-15-24(31(32,33)34)19-26(16-20)44(42,43)37-14-6-9-28(37)29(39)36-27(30(40)41)18-23-12-10-22(11-13-23)17-25(38)8-5-3-4-7-21(2)35/h10-13,15-16,19,27-28,35H,3-9,14,17-18H2,1-2H3,(H,36,39)(H,40,41)/b35-21+/t27?,28-/m0/s1 |
| InChIKey | IDTBSZPBXAOQPS-VXNBPJHVSA-N |
| XLogP | 5.08 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|