C28H37N3O6S — CID 159765068
2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-(7-iminooctoxy)phenyl]propanoic acid (PubChem CID 159765068) has the molecular formula C28H37N3O6S and a molecular weight of 543.69 g/mol. Its IUPAC name is 2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-(7-iminooctoxy)phenyl]propanoic acid.
| Compound Name | 2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-(7-iminooctoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 159765068 |
| Molecular Formula | C28H37N3O6S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-(7-iminooctoxy)phenyl]propanoic acid |
| SMILES | [H]/N=C(\C)CCCCCCOc1ccc(CC(NC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C28H37N3O6S/c1-21(29)10-5-2-3-8-19-37-23-16-14-22(15-17-23)20-25(28(33)34)30-27(32)26-13-9-18-31(26)38(35,36)24-11-6-4-7-12-24/h4,6-7,11-12,14-17,25-26,29H,2-3,5,8-10,13,18-20H2,1H3,(H,30,32)(H,33,34)/b29-21+/t25?,26-/m0/s1 |
| InChIKey | WYCJFFPATHSUOZ-DSPCVXQYSA-N |
| XLogP | 4.02 |
| TPSA | 136.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|