C24H28Cl2N2O7S — CID 20793907
(2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-ethoxyethoxy)phenyl]propanoic acid (PubChem CID 20793907) has the molecular formula C24H28Cl2N2O7S and a molecular weight of 559.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-ethoxyethoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-ethoxyethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 20793907 |
| Molecular Formula | C24H28Cl2N2O7S |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-ethoxyethoxy)phenyl]propanoic acid |
| SMILES | CCOCCOc1ccc(C[C@H](NC(=O)[C@@H]2CCCN2S(=O)(=O)c2cc(Cl)cc(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H28Cl2N2O7S/c1-2-34-10-11-35-19-7-5-16(6-8-19)12-21(24(30)31)27-23(29)22-4-3-9-28(22)36(32,33)20-14-17(25)13-18(26)15-20/h5-8,13-15,21-22H,2-4,9-12H2,1H3,(H,27,29)(H,30,31)/t21-,22-/m0/s1 |
| InChIKey | DQRNPFVDEBNCMO-VXKWHMMOSA-N |
| XLogP | 3.37 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|