C29H33Cl2N5O8S — CID 68816464
(2S)-3-[4-[4-(4-acetamidobutyl)-2,5-dioxoimidazolidin-1-yl]phenyl]-2-[[(2R)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 68816464) has the molecular formula C29H33Cl2N5O8S and a molecular weight of 682.58 g/mol. Its IUPAC name is (2S)-3-[4-[4-(4-acetamidobutyl)-2,5-dioxoimidazolidin-1-yl]phenyl]-2-[[(2R)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-[4-(4-acetamidobutyl)-2,5-dioxoimidazolidin-1-yl]phenyl]-2-[[(2R)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 68816464 |
| Molecular Formula | C29H33Cl2N5O8S |
| Molecular Weight | 682.58 g/mol |
| Exact Mass | 681.14 |
| IUPAC Name | (2S)-3-[4-[4-(4-acetamidobutyl)-2,5-dioxoimidazolidin-1-yl]phenyl]-2-[[(2R)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | CC(=O)NCCCCC1NC(=O)N(c2ccc(C[C@H](NC(=O)[C@H]3CCCN3S(=O)(=O)c3cc(Cl)cc(Cl)c3)C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C29H33Cl2N5O8S/c1-17(37)32-11-3-2-5-23-27(39)36(29(42)34-23)21-9-7-18(8-10-21)13-24(28(40)41)33-26(38)25-6-4-12-35(25)45(43,44)22-15-19(30)14-20(31)16-22/h7-10,14-16,23-25H,2-6,11-13H2,1H3,(H,32,37)(H,33,38)(H,34,42)(H,40,41)/t23?,24-,25+/m0/s1 |
| InChIKey | WEBPKVFRQPCOHP-NCPLZGKYSA-N |
| XLogP | 2.69 |
| TPSA | 182.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|