C27H26Cl2N2O6S2 — CID 20726167
(2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylazetidine-2-carbothioyl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid (PubChem CID 20726167) has the molecular formula C27H26Cl2N2O6S2 and a molecular weight of 609.55 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylazetidine-2-carbothioyl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylazetidine-2-carbothioyl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 20726167 |
| Molecular Formula | C27H26Cl2N2O6S2 |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 608.06 |
| IUPAC Name | (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylazetidine-2-carbothioyl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid |
| SMILES | COc1cccc(OC)c1-c1ccc(C[C@H](NC(=S)[C@@H]2CCN2S(=O)(=O)c2cc(Cl)cc(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H26Cl2N2O6S2/c1-36-23-4-3-5-24(37-2)25(23)17-8-6-16(7-9-17)12-21(27(32)33)30-26(38)22-10-11-31(22)39(34,35)20-14-18(28)13-19(29)15-20/h3-9,13-15,21-22H,10-12H2,1-2H3,(H,30,38)(H,32,33)/t21-,22-/m0/s1 |
| InChIKey | QWXCBVXDRXWCCY-VXKWHMMOSA-N |
| XLogP | 5.05 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|