C31H36N4O5S2 — CID 87878003
(2S)-2-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(3-phenylpropylcarbamothioylamino)phenyl]propanoic acid (PubChem CID 87878003) has the molecular formula C31H36N4O5S2 and a molecular weight of 608.79 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(3-phenylpropylcarbamothioylamino)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(3-phenylpropylcarbamothioylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 87878003 |
| Molecular Formula | C31H36N4O5S2 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | (2S)-2-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(3-phenylpropylcarbamothioylamino)phenyl]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc2ccc(NC(=S)NCCCc3ccccc3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C31H36N4O5S2/c1-22-11-17-26(18-12-22)42(39,40)35-20-6-10-28(35)29(36)34-27(30(37)38)21-24-13-15-25(16-14-24)33-31(41)32-19-5-9-23-7-3-2-4-8-23/h2-4,7-8,11-18,27-28H,5-6,9-10,19-21H2,1H3,(H,34,36)(H,37,38)(H2,32,33,41)/t27-,28-/m0/s1 |
| InChIKey | ZHGFWLJJUHELDG-NSOVKSMOSA-N |
| XLogP | 3.88 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|