C24H30N6O6S — CID 135377137
2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-[3-(diaminomethylideneamino)propanoylamino]phenyl]propanoic acid (PubChem CID 135377137) has the molecular formula C24H30N6O6S and a molecular weight of 530.61 g/mol. Its IUPAC name is 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-[3-(diaminomethylideneamino)propanoylamino]phenyl]propanoic acid.
| Compound Name | 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-[3-(diaminomethylideneamino)propanoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135377137 |
| Molecular Formula | C24H30N6O6S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-[3-(diaminomethylideneamino)propanoylamino]phenyl]propanoic acid |
| SMILES | NC(N)=NCCC(=O)Nc1ccc(CC(NC(=O)C2CCCN2S(=O)(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H30N6O6S/c25-24(26)27-13-12-21(31)28-17-10-8-16(9-11-17)15-19(23(33)34)29-22(32)20-7-4-14-30(20)37(35,36)18-5-2-1-3-6-18/h1-3,5-6,8-11,19-20H,4,7,12-15H2,(H,28,31)(H,29,32)(H,33,34)(H4,25,26,27) |
| InChIKey | NQGYZJOUXGPHEL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 197.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|