C21H33N7O6S — CID 131977626
2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[5-(diaminomethylideneamino)pentylcarbamoylamino]propanoic acid (PubChem CID 131977626) has the molecular formula C21H33N7O6S and a molecular weight of 511.61 g/mol. Its IUPAC name is 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[5-(diaminomethylideneamino)pentylcarbamoylamino]propanoic acid.
| Compound Name | 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[5-(diaminomethylideneamino)pentylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 131977626 |
| Molecular Formula | C21H33N7O6S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[5-(diaminomethylideneamino)pentylcarbamoylamino]propanoic acid |
| SMILES | NC(N)=NCCCCCNC(=O)NCC(NC(=O)C1CCCN1S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H33N7O6S/c22-20(23)24-11-5-2-6-12-25-21(32)26-14-16(19(30)31)27-18(29)17-10-7-13-28(17)35(33,34)15-8-3-1-4-9-15/h1,3-4,8-9,16-17H,2,5-7,10-14H2,(H,27,29)(H,30,31)(H4,22,23,24)(H2,25,26,32) |
| InChIKey | ZEDVVTNZWFMRKR-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 209.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|