C21H33N5O6S — CID 138611813
3-(6-aminohexylcarbamoylamino)-2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 138611813) has the molecular formula C21H33N5O6S and a molecular weight of 483.59 g/mol. Its IUPAC name is 3-(6-aminohexylcarbamoylamino)-2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-(6-aminohexylcarbamoylamino)-2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 138611813 |
| Molecular Formula | C21H33N5O6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 3-(6-aminohexylcarbamoylamino)-2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | NCCCCCCNC(=O)NCC(NC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H33N5O6S/c22-12-6-1-2-7-13-23-21(30)24-15-17(20(28)29)25-19(27)18-11-8-14-26(18)33(31,32)16-9-4-3-5-10-16/h3-5,9-10,17-18H,1-2,6-8,11-15,22H2,(H,25,27)(H,28,29)(H2,23,24,30)/t17?,18-/m0/s1 |
| InChIKey | GEEWIZURHGFXGL-ZVAWYAOSSA-N |
| XLogP | 0.23 |
| TPSA | 170.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|