C30H45N7O10S — CID 138632912
2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[[2-[5-(carbamoylamino)pentanoylamino]-6-(prop-2-enoxycarbonylamino)hexanoyl]amino]propanoic acid (PubChem CID 138632912) has the molecular formula C30H45N7O10S and a molecular weight of 695.80 g/mol. Its IUPAC name is 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[[2-[5-(carbamoylamino)pentanoylamino]-6-(prop-2-enoxycarbonylamino)hexanoyl]amino]propanoic acid.
| Compound Name | 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[[2-[5-(carbamoylamino)pentanoylamino]-6-(prop-2-enoxycarbonylamino)hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 138632912 |
| Molecular Formula | C30H45N7O10S |
| Molecular Weight | 695.80 g/mol |
| Exact Mass | 695.29 |
| IUPAC Name | 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[[2-[5-(carbamoylamino)pentanoylamino]-6-(prop-2-enoxycarbonylamino)hexanoyl]amino]propanoic acid |
| SMILES | C=CCOC(=O)NCCCCC(NC(=O)CCCCNC(N)=O)C(=O)NCC(NC(=O)C1CCCN1S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H45N7O10S/c1-2-19-47-30(44)33-17-8-6-13-22(35-25(38)15-7-9-16-32-29(31)43)26(39)34-20-23(28(41)42)36-27(40)24-14-10-18-37(24)48(45,46)21-11-4-3-5-12-21/h2-5,11-12,22-24H,1,6-10,13-20H2,(H,33,44)(H,34,39)(H,35,38)(H,36,40)(H,41,42)(H3,31,32,43) |
| InChIKey | XBZJLYLSBMVPHJ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 255.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.80 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|