C20H31N5O6S — CID 138611850
3-(5-aminopentylcarbamoylamino)-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 138611850) has the molecular formula C20H31N5O6S and a molecular weight of 469.56 g/mol. Its IUPAC name is 3-(5-aminopentylcarbamoylamino)-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-(5-aminopentylcarbamoylamino)-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 138611850 |
| Molecular Formula | C20H31N5O6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-(5-aminopentylcarbamoylamino)-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | NCCCCCNC(=O)NCC(NC(=O)C1CCCN1S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H31N5O6S/c21-11-5-2-6-12-22-20(29)23-14-16(19(27)28)24-18(26)17-10-7-13-25(17)32(30,31)15-8-3-1-4-9-15/h1,3-4,8-9,16-17H,2,5-7,10-14,21H2,(H,24,26)(H,27,28)(H2,22,23,29) |
| InChIKey | NIOGLFCHJZBZPQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 170.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|