C17H24N2O5S — CID 120615275
(2S)-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 120615275) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is (2S)-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120615275 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (2S)-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C1CCCN1S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H24N2O5S/c1-2-3-10-14(17(21)22)18-16(20)15-11-7-12-19(15)25(23,24)13-8-5-4-6-9-13/h4-6,8-9,14-15H,2-3,7,10-12H2,1H3,(H,18,20)(H,21,22)/t14-,15?/m0/s1 |
| InChIKey | ABEYQAPVGFIHRM-MLCCFXAWSA-N |
| XLogP | 1.60 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |