C15H21N5O6S — CID 138611847
2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-(hydrazinecarbonylamino)propanoic acid (PubChem CID 138611847) has the molecular formula C15H21N5O6S and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-(hydrazinecarbonylamino)propanoic acid.
| Compound Name | 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-(hydrazinecarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 138611847 |
| Molecular Formula | C15H21N5O6S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-(hydrazinecarbonylamino)propanoic acid |
| SMILES | NNC(=O)NCC(NC(=O)C1CCCN1S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H21N5O6S/c16-19-15(24)17-9-11(14(22)23)18-13(21)12-7-4-8-20(12)27(25,26)10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,16H2,(H,18,21)(H,22,23)(H2,17,19,24) |
| InChIKey | XOJYZZGRNQGGMJ-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 170.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|