C32H48N6O9S — CID 160543530
6-[5-(1-aminoethylideneamino)pentanoylamino]-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-5-oxo-10-(prop-2-enoxycarbonylamino)decanoic acid (PubChem CID 160543530) has the molecular formula C32H48N6O9S and a molecular weight of 692.84 g/mol. Its IUPAC name is 6-[5-(1-aminoethylideneamino)pentanoylamino]-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-5-oxo-10-(prop-2-enoxycarbonylamino)decanoic acid.
| Compound Name | 6-[5-(1-aminoethylideneamino)pentanoylamino]-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-5-oxo-10-(prop-2-enoxycarbonylamino)decanoic acid |
|---|---|
| PubChem CID | 160543530 |
| Molecular Formula | C32H48N6O9S |
| Molecular Weight | 692.84 g/mol |
| Exact Mass | 692.32 |
| IUPAC Name | 6-[5-(1-aminoethylideneamino)pentanoylamino]-2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-5-oxo-10-(prop-2-enoxycarbonylamino)decanoic acid |
| SMILES | C=CCOC(=O)NCCCCC(NC(=O)CCCC/N=C(\C)N)C(=O)CCC(NC(=O)C1CCCN1S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C32H48N6O9S/c1-3-22-47-32(44)35-20-9-7-14-25(36-29(40)16-8-10-19-34-23(2)33)28(39)18-17-26(31(42)43)37-30(41)27-15-11-21-38(27)48(45,46)24-12-5-4-6-13-24/h3-6,12-13,25-27H,1,7-11,14-22H2,2H3,(H2,33,34)(H,35,44)(H,36,40)(H,37,41)(H,42,43) |
| InChIKey | QXCNWKMCXZZZRX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 226.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.84 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|